afolabiv881
afolabiv881 afolabiv881
  • 18-01-2021
  • Mathematics
contestada

Plss i really need answer urgently asap​

Plss i really need answer urgently asap class=

Respuesta :

ankkisi ankkisi
  • 18-01-2021

Answer:

i have no clue

Step-by-step explanation:

Answer Link

Otras preguntas

How would you explain that some blind individuals do not have sleep problems?
Human females start to form eggs, or ova, at puberty.
What is the lewis structure of the covalent compound that contains one nitrogen atom, one hydrogen atom, and one carbon atom?
A patient has been diagnosed with a concussion. he is to be released from the emergency department. the nurse teaches the family or friends who will be caring f
What does a sound scientific conclusion most likely rely upon?
Line segment SU is dilated to create S'U' using point Q as the center of dilation. The scale factor of the dilation is:
chlorofluorocarbons(CFCs) damage the ozone layer.Where do these chemicals come from?
If you deposit $5,000 in a bank account that pays 4% interest annually, how much will be in your account after 5 years? round your answer to the nearest cent.
Phones have been around for a while now and they keep getting smarter and smarter. Phones have helped us human in a lot of ways, but are they really helping u
Behavioral models of management sees managers as being ________ than does the classical model.