Andy100100 Andy100100

19-12-2020
Biology

contestada

Does anyone knows the skeletal structure for this one?

Does anyone knows the skeletal structure for this one class=

Respuesta :

raduoprea160 raduoprea160

19-12-2020

CH3-CH(CH3)-CH2-CH2-CH2-C(CH3)2-CH(CH3)-CH3

it's named

2,3,3,7-tertamethyloctane

Ver imagen raduoprea160

Answer Link

Otras preguntas

Extended sunbathing however isn't a healthy way to obtain vitamin D.

Oil spills are a very serious form of pollution. They severely affect marine biodiversity and coastal ecosystems. The table shows methods that can be used to co

Why did the United States get involved in the Vietnam conflict? a. To keep communism from spreading in the region. b. To force Vietnam to sign a peace treaty cr

Name 3 embarrassing moments that happened to you and the one that is really embarrassing will get brainliest

How does Tennyson effectively retell King Arthur and Sir Bedivere’s interaction? Tennyson adds additional sorrow to the scene by describing the water. Tennyson

What does the image of "in conquest stretched mine arm so far" suggest about the meaning of the passage? caesar’s arms are tired from battle, and he wants to st

Why was the 27th Amendment passed?to expand the fiscal powers of the presidentto limit the number of terms a president can serveto increase the war powers of th

What does the allusion mean? You have identified John Hancock as the allusion used in this passage. Click the Hancock tab to read more. A. It means that the pr

What is the function of the dendrites of a neuron? A. They pick up signals and send them to the cell body. B. They make more neurons. C. They connect the neuron

A box of cereal has a volume of 144 inches squared. the height of the cereal box is 12 inches, and the depth is 2 inches. what is the width of the cereal box?