betty5992001 betty5992001

19-03-2020
Mathematics

contestada

Sarah purchased $15.75 worth of coffee that sold for $.25 per pound how many pounds of coffee did Sarah buy?

Respuesta :

livithebunny16 livithebunny16

19-03-2020

Answer:

63

Step-by-step explanation:

15.75 divided by .25 and you get 63. :3

Answer Link

19-03-2020

$15.75/$.25= 63pounds

Answer Link

Otras preguntas

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(

Corrine has 10 pounds of trail mix to divide into 8 bags.How many pounds of trail mix will go in each bag?

With which civil war amendment is the twenty-fourth amendment most closely connected?

The electricity bill of sarah's house for the last month was $60, while for this month it is $120. if p is the percent increase in the amount, which proportion

Why are we here? How is life even possible?

Which accurately describes a scientific innovation of the renaissance and its impact? the bessemer method increased the production of steel and led to growth of

The _______ model of decision making assumes that managers are completely objective and possess all information for their decisions. in this model, decisions de

how do you graph y=-x+11

In contrast to earlier historians who viewed reconstruction in negative terms and focused on the era's tragedies and graft, corruption, high taxes, and huge pub

Why does grass not grow during the winter months?