seanjojo2234 seanjojo2234
  • 18-11-2019
  • Physics
contestada

sin100cos40-cos100sin40​

Respuesta :

SouthernRider
SouthernRider SouthernRider
  • 23-11-2019

Answer:

Sin(60°)=[tex]\frac{\sqrt{3} }{2}[/tex]

Explanation:

Assuming the given angles are in degrees

We know that Sin(A-B)=SinACosB-CosASinB

Here A=100° and B=40°

[tex]Sin(100)Cos(40)-Cos(100)Sin(40)=Sin(100-40)=Sin(60)=\frac{\sqrt{3} }{2}[/tex]

Answer Link

Otras preguntas

why would closed borders help protect citizens jobs?
determine the moles of sulfuric acid formed from 3.20 mol of sulfur dioxide
Predict the polarity of 6 real molecules (O2, HF, H2O, NH3, CF4, CH3F). First, draw the molecules and any bond dipoles. Then draw any molecular dipoles. Explain
A line has a slope of -3 and includes the points (9, 4) and (8, t). What is the value of t?
Which of the following are possible demand options for dealing with demand-capacity mismatches? A) Back orders. B) New demand. C) Overtime D) Part time.
Can anyone help? Plsss
question 2 when implemented, which of the following strategies would provide information about customer behaviors that could lead to an effective launch of a ne
Why is it important to prevent discrimination?.
Kendra was at a concert. While leaving the police pick her out of a crowd (for no reason) and search her person and her items. What piece of legislation protect
the pertussis toxin B oligomer (PTX-B), and the PTX mutant PT9K/129G, which is safely administered in vivo, inhibit both transcription and secretion of TGF-beta